C14H26O3 — CID 114991682
1-(2-methylpropoxy)-4-propylcyclohexane-1-carboxylic acid (PubChem CID 114991682) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(2-methylpropoxy)-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-methylpropoxy)-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114991682 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 1-(2-methylpropoxy)-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(OCC(C)C)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H26O3/c1-4-5-12-6-8-14(9-7-12,13(15)16)17-10-11(2)3/h11-12H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | KYQXENVHNAUNQB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |