C9H14F4O3 — CID 114993097
2-methyl-2-(2,2,3,3-tetrafluoropropoxy)pentanoic acid (PubChem CID 114993097) has the molecular formula C9H14F4O3 and a molecular weight of 246.20 g/mol. Its IUPAC name is 2-methyl-2-(2,2,3,3-tetrafluoropropoxy)pentanoic acid.
| Compound Name | 2-methyl-2-(2,2,3,3-tetrafluoropropoxy)pentanoic acid |
|---|---|
| PubChem CID | 114993097 |
| Molecular Formula | C9H14F4O3 |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-methyl-2-(2,2,3,3-tetrafluoropropoxy)pentanoic acid |
| SMILES | CCCC(C)(OCC(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C9H14F4O3/c1-3-4-8(2,7(14)15)16-5-9(12,13)6(10)11/h6H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | MYYFYZZDIQYHIR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|