C10H20NO2 — CID 11499342
CID 11499342 (PubChem CID 11499342) has the molecular formula C10H20NO2 and a molecular weight of 186.27 g/mol.
| Compound Name | CID 11499342 |
|---|---|
| PubChem CID | 11499342 |
| Molecular Formula | C10H20NO2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC1CCC(C)(C)N1[O] |
| InChI | InChI=1S/C10H20NO2/c1-9(2,3)13-8-6-7-10(4,5)11(8)12/h8H,6-7H2,1-5H3 |
| InChIKey | QEUDFARHUGPXIP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |