C16H32NO2 — CID 58350267
CID 58350267 (PubChem CID 58350267) has the molecular formula C16H32NO2 and a molecular weight of 270.44 g/mol.
| Compound Name | CID 58350267 |
|---|---|
| PubChem CID | 58350267 |
| Molecular Formula | C16H32NO2 |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(C)(C)C(C)(C)C)CC(C)(C)N1[O] |
| InChI | InChI=1S/C16H32NO2/c1-13(2,3)16(8,9)19-12-10-14(4,5)17(18)15(6,7)11-12/h12H,10-11H2,1-9H3 |
| InChIKey | FAWCGUULKRCCCQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |