About CID 58350267
CID 58350267 (PubChem CID 58350267) has the molecular formula C16H32NO2
and a molecular weight of 270.44 g/mol.
Molecular Properties
| Compound Name | CID 58350267 |
| PubChem CID | 58350267 |
| Molecular Formula | C16H32NO2 |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(C)(C)C(C)(C)C)CC(C)(C)N1[O] |
| InChI | InChI=1S/C16H32NO2/c1-13(2,3)16(8,9)19-12-10-14(4,5)17(18)15(6,7)11-12/h12H,10-11H2,1-9H3 |
| InChIKey | FAWCGUULKRCCCQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 58350267 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58350267?
The IUPAC name of CID 58350267 (CID 58350267) is not available.
What is the SMILES notation for CID 58350267?
The canonical SMILES for CID 58350267 is CC1(C)CC(OC(C)(C)C(C)(C)C)CC(C)(C)N1[O].
What is the InChIKey of CID 58350267?
The InChIKey is FAWCGUULKRCCCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32NO2/c1-13(2,3)16(8,9)19-12-10-14(4,5)17(18)15(6,7)11-12/h12H,10-11H2,1-9H3.
What are the key properties of CID 58350267?
CID 58350267 has a molecular weight of 270.44 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58350267 is sourced from PubChem (CID 58350267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).