C11H23NO2 — CID 19784858
1,4-dimethoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 19784858) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 1,4-dimethoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1,4-dimethoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 19784858 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1,4-dimethoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | COC1CC(C)(C)N(OC)C(C)(C)C1 |
| InChI | InChI=1S/C11H23NO2/c1-10(2)7-9(13-5)8-11(3,4)12(10)14-6/h9H,7-8H2,1-6H3 |
| InChIKey | YDIPJBVMLZOTDH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |