C12H17N5O2 — CID 11499921
ethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate (PubChem CID 11499921) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is ethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate.
| Compound Name | ethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate |
|---|---|
| PubChem CID | 11499921 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | ethyl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate |
| SMILES | CCOC(=O)NN(CC(C)C)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C12H17N5O2/c1-4-19-12(18)16-17(8-9(2)3)11-5-6-14-10(7-13)15-11/h5-6,9H,4,8H2,1-3H3,(H,16,18) |
| InChIKey | ULBORZNCOXYDQX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|