C16H22F3N5O4 — CID 11517011
butan-2-yl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 11517011) has the molecular formula C16H22F3N5O4 and a molecular weight of 405.38 g/mol. Its IUPAC name is butan-2-yl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | butan-2-yl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11517011 |
| Molecular Formula | C16H22F3N5O4 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | butan-2-yl N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CCC(C)OC(=O)NN(CC(C)C)c1ccnc(C#N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N5O2.C2HF3O2/c1-5-11(4)21-14(20)18-19(9-10(2)3)13-6-7-16-12(8-15)17-13;3-2(4,5)1(6)7/h6-7,10-11H,5,9H2,1-4H3,(H,18,20);(H,6,7) |
| InChIKey | CFKJQUJGUKVFDV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|