C17H24F3N5O3 — CID 11589472
N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)hexanehydrazide;2,2,2-trifluoroacetic acid (PubChem CID 11589472) has the molecular formula C17H24F3N5O3 and a molecular weight of 403.41 g/mol. Its IUPAC name is N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)hexanehydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)hexanehydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11589472 |
| Molecular Formula | C17H24F3N5O3 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)hexanehydrazide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCC(=O)NN(CC(C)C)c1ccnc(C#N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N5O.C2HF3O2/c1-4-5-6-7-15(21)19-20(11-12(2)3)14-8-9-17-13(10-16)18-14;3-2(4,5)1(6)7/h8-9,12H,4-7,11H2,1-3H3,(H,19,21);(H,6,7) |
| InChIKey | HAQOMZGSNHRJQM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|