C16H22F3N5O3 — CID 11689631
N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)pentanehydrazide;2,2,2-trifluoroacetic acid (PubChem CID 11689631) has the molecular formula C16H22F3N5O3 and a molecular weight of 389.38 g/mol. Its IUPAC name is N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)pentanehydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)pentanehydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11689631 |
| Molecular Formula | C16H22F3N5O3 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N'-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)pentanehydrazide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC(=O)NN(CC(C)C)c1ccnc(C#N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N5O.C2HF3O2/c1-4-5-6-14(20)18-19(10-11(2)3)13-7-8-16-12(9-15)17-13;3-2(4,5)1(6)7/h7-8,11H,4-6,10H2,1-3H3,(H,18,20);(H,6,7) |
| InChIKey | XRVOAICYKRQYHK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|