C9H18N2O2S — CID 114999238
4-(3-aminopropylamino)thiane-4-carboxylic acid (PubChem CID 114999238) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-(3-aminopropylamino)thiane-4-carboxylic acid.
| Compound Name | 4-(3-aminopropylamino)thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 114999238 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4-(3-aminopropylamino)thiane-4-carboxylic acid |
| SMILES | NCCCNC1(C(=O)O)CCSCC1 |
| InChI | InChI=1S/C9H18N2O2S/c10-4-1-5-11-9(8(12)13)2-6-14-7-3-9/h11H,1-7,10H2,(H,12,13) |
| InChIKey | RLISCPLYUYBQFK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|