C12H14N2O — CID 114999401
(2-aminocyclopropyl)-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 114999401) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (2-aminocyclopropyl)-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | (2-aminocyclopropyl)-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 114999401 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (2-aminocyclopropyl)-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | NC1CC1C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H14N2O/c13-11-5-10(11)12(15)14-6-8-3-1-2-4-9(8)7-14/h1-4,10-11H,5-7,13H2 |
| InChIKey | OMURZENSGLBKJA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |