C15H25NO — CID 115002182
2-(3,4-dimethylphenyl)-4-propan-2-yloxybutan-2-amine (PubChem CID 115002182) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-4-propan-2-yloxybutan-2-amine.
| Compound Name | 2-(3,4-dimethylphenyl)-4-propan-2-yloxybutan-2-amine |
|---|---|
| PubChem CID | 115002182 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-4-propan-2-yloxybutan-2-amine |
| SMILES | Cc1ccc(C(C)(N)CCOC(C)C)cc1C |
| InChI | InChI=1S/C15H25NO/c1-11(2)17-9-8-15(5,16)14-7-6-12(3)13(4)10-14/h6-7,10-11H,8-9,16H2,1-5H3 |
| InChIKey | NSTVOLRNXAQQPM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |