C11H11ClN2O3 — CID 115003616
3-amino-2-(5-chloro-2-oxo-1,3-dihydroindol-7-yl)propanoic acid (PubChem CID 115003616) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 3-amino-2-(5-chloro-2-oxo-1,3-dihydroindol-7-yl)propanoic acid.
| Compound Name | 3-amino-2-(5-chloro-2-oxo-1,3-dihydroindol-7-yl)propanoic acid |
|---|---|
| PubChem CID | 115003616 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-amino-2-(5-chloro-2-oxo-1,3-dihydroindol-7-yl)propanoic acid |
| SMILES | NCC(C(=O)O)c1cc(Cl)cc2c1NC(=O)C2 |
| InChI | InChI=1S/C11H11ClN2O3/c12-6-1-5-2-9(15)14-10(5)7(3-6)8(4-13)11(16)17/h1,3,8H,2,4,13H2,(H,14,15)(H,16,17) |
| InChIKey | HFNVDDGXKYPPAK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |