C16H15NO2 — CID 115009002
1-(5-phenyl-3-pyridinyl)cyclobutane-1-carboxylic acid (PubChem CID 115009002) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(5-phenyl-3-pyridinyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(5-phenyl-3-pyridinyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115009002 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-(5-phenyl-3-pyridinyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cncc(-c3ccccc3)c2)CCC1 |
| InChI | InChI=1S/C16H15NO2/c18-15(19)16(7-4-8-16)14-9-13(10-17-11-14)12-5-2-1-3-6-12/h1-3,5-6,9-11H,4,7-8H2,(H,18,19) |
| InChIKey | FWGATNYALQFVSN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |