C11H10F3NO2 — CID 115009001
1-[5-(trifluoromethyl)-3-pyridinyl]cyclobutane-1-carboxylic acid (PubChem CID 115009001) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-3-pyridinyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[5-(trifluoromethyl)-3-pyridinyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115009001 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-[5-(trifluoromethyl)-3-pyridinyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cncc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C11H10F3NO2/c12-11(13,14)8-4-7(5-15-6-8)10(9(16)17)2-1-3-10/h4-6H,1-3H2,(H,16,17) |
| InChIKey | FXUNLWMENKUYPI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |