C17H28N2O5 — CID 11501007
dimethyl 7a-tert-butyl-2,2,3,3-tetramethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate (PubChem CID 11501007) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is dimethyl 7a-tert-butyl-2,2,3,3-tetramethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate.
| Compound Name | dimethyl 7a-tert-butyl-2,2,3,3-tetramethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11501007 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | dimethyl 7a-tert-butyl-2,2,3,3-tetramethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(C)(C)C)NC(C)(C)C(C)(C)N2O1 |
| InChI | InChI=1S/C17H28N2O5/c1-14(2,3)17-10(12(20)22-8)11(13(21)23-9)24-19(17)16(6,7)15(4,5)18-17/h18H,1-9H3 |
| InChIKey | YKYLQMSNUMHYGZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |