C14H19F3N2O5 — CID 11681860
dimethyl 2,2,3,3-tetramethyl-7a-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate (PubChem CID 11681860) has the molecular formula C14H19F3N2O5 and a molecular weight of 352.31 g/mol. Its IUPAC name is dimethyl 2,2,3,3-tetramethyl-7a-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate.
| Compound Name | dimethyl 2,2,3,3-tetramethyl-7a-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11681860 |
| Molecular Formula | C14H19F3N2O5 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | dimethyl 2,2,3,3-tetramethyl-7a-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(F)(F)F)NC(C)(C)C(C)(C)N2O1 |
| InChI | InChI=1S/C14H19F3N2O5/c1-11(2)12(3,4)19-13(18-11,14(15,16)17)7(9(20)22-5)8(24-19)10(21)23-6/h18H,1-6H3 |
| InChIKey | FTCRUBMDJPLHOK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |