C14H21F3N2O3 — CID 11537083
ethyl 2,2,3,3,7a-pentamethyl-6-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-7-carboxylate (PubChem CID 11537083) has the molecular formula C14H21F3N2O3 and a molecular weight of 322.33 g/mol. Its IUPAC name is ethyl 2,2,3,3,7a-pentamethyl-6-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-7-carboxylate.
| Compound Name | ethyl 2,2,3,3,7a-pentamethyl-6-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-7-carboxylate |
|---|---|
| PubChem CID | 11537083 |
| Molecular Formula | C14H21F3N2O3 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | ethyl 2,2,3,3,7a-pentamethyl-6-(trifluoromethyl)-1H-imidazo[1,2-b][1,2]oxazole-7-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)ON2C1(C)NC(C)(C)C2(C)C |
| InChI | InChI=1S/C14H21F3N2O3/c1-7-21-10(20)8-9(14(15,16)17)22-19-12(4,5)11(2,3)18-13(8,19)6/h18H,7H2,1-6H3 |
| InChIKey | NOOPNGJZXDRUKN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |