C14H19F3N2O6 — CID 11660660
dimethyl 1-hydroxy-2,2,3,3-tetramethyl-7a-(trifluoromethyl)imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate (PubChem CID 11660660) has the molecular formula C14H19F3N2O6 and a molecular weight of 368.31 g/mol. Its IUPAC name is dimethyl 1-hydroxy-2,2,3,3-tetramethyl-7a-(trifluoromethyl)imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate.
| Compound Name | dimethyl 1-hydroxy-2,2,3,3-tetramethyl-7a-(trifluoromethyl)imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11660660 |
| Molecular Formula | C14H19F3N2O6 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | dimethyl 1-hydroxy-2,2,3,3-tetramethyl-7a-(trifluoromethyl)imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(F)(F)F)N(O)C(C)(C)C(C)(C)N2O1 |
| InChI | InChI=1S/C14H19F3N2O6/c1-11(2)12(3,4)19-13(18(11)22,14(15,16)17)7(9(20)23-5)8(25-19)10(21)24-6/h22H,1-6H3 |
| InChIKey | JMMJYFGTHDWAFI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |