C15H24N2O5 — CID 11695310
dimethyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate (PubChem CID 11695310) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is dimethyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate.
| Compound Name | dimethyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11695310 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | dimethyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C)N(C)C(C)(C)C(C)(C)N2O1 |
| InChI | InChI=1S/C15H24N2O5/c1-13(2)14(3,4)17-15(5,16(13)6)9(11(18)20-7)10(22-17)12(19)21-8/h1-8H3 |
| InChIKey | CIUAMXJZYDBKCQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |