C14H22N2O5 — CID 11637977
dimethyl 2,2,3,3,7a-pentamethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate (PubChem CID 11637977) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is dimethyl 2,2,3,3,7a-pentamethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate.
| Compound Name | dimethyl 2,2,3,3,7a-pentamethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11637977 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | dimethyl 2,2,3,3,7a-pentamethyl-1H-imidazo[1,2-b][1,2]oxazole-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C)NC(C)(C)C(C)(C)N2O1 |
| InChI | InChI=1S/C14H22N2O5/c1-12(2)13(3,4)16-14(5,15-12)8(10(17)19-6)9(21-16)11(18)20-7/h15H,1-7H3 |
| InChIKey | WTFXDNHHGJGPQH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |