C12H15BrO — CID 115010739
8-bromo-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-ol (PubChem CID 115010739) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 8-bromo-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-ol.
| Compound Name | 8-bromo-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 115010739 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 8-bromo-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-ol |
| SMILES | CC1(C)c2c(Br)cccc2CCC1O |
| InChI | InChI=1S/C12H15BrO/c1-12(2)10(14)7-6-8-4-3-5-9(13)11(8)12/h3-5,10,14H,6-7H2,1-2H3 |
| InChIKey | ZMBYJOJLEQEEFX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |