C9H6Br2F3N — CID 11501095
2-(2,2-dibromoethenyl)-5-(trifluoromethyl)aniline (PubChem CID 11501095) has the molecular formula C9H6Br2F3N and a molecular weight of 344.96 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-(2,2-dibromoethenyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 11501095 |
| Molecular Formula | C9H6Br2F3N |
| Molecular Weight | 344.96 g/mol |
| Exact Mass | 342.88 |
| IUPAC Name | 2-(2,2-dibromoethenyl)-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1C=C(Br)Br |
| InChI | InChI=1S/C9H6Br2F3N/c10-8(11)3-5-1-2-6(4-7(5)15)9(12,13)14/h1-4H,15H2 |
| InChIKey | FIKXHFBTBWQVSK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|