C9H9Br2NO — CID 164872734
2-(2,2-dibromoethenyl)-5-methoxyaniline (PubChem CID 164872734) has the molecular formula C9H9Br2NO and a molecular weight of 306.99 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)-5-methoxyaniline.
| Compound Name | 2-(2,2-dibromoethenyl)-5-methoxyaniline |
|---|---|
| PubChem CID | 164872734 |
| Molecular Formula | C9H9Br2NO |
| Molecular Weight | 306.99 g/mol |
| Exact Mass | 304.91 |
| IUPAC Name | 2-(2,2-dibromoethenyl)-5-methoxyaniline |
| SMILES | COc1ccc(C=C(Br)Br)c(N)c1 |
| InChI | InChI=1S/C9H9Br2NO/c1-13-7-3-2-6(4-9(10)11)8(12)5-7/h2-5H,12H2,1H3 |
| InChIKey | VMKHJWRKVHFXRU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|