C8H10N4 — CID 115012751
3-ethylimidazo[4,5-c]pyridin-6-amine (PubChem CID 115012751) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 3-ethylimidazo[4,5-c]pyridin-6-amine.
| Compound Name | 3-ethylimidazo[4,5-c]pyridin-6-amine |
|---|---|
| PubChem CID | 115012751 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-ethylimidazo[4,5-c]pyridin-6-amine |
| SMILES | CCn1cnc2cc(N)ncc21 |
| InChI | InChI=1S/C8H10N4/c1-2-12-5-11-6-3-8(9)10-4-7(6)12/h3-5H,2H2,1H3,(H2,9,10) |
| InChIKey | VNHZORHHXSPZIC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |