C12H12N4S — CID 82497594
4-(1-ethylbenzimidazol-5-yl)-1,3-thiazol-2-amine (PubChem CID 82497594) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-(1-ethylbenzimidazol-5-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1-ethylbenzimidazol-5-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82497594 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-(1-ethylbenzimidazol-5-yl)-1,3-thiazol-2-amine |
| SMILES | CCn1cnc2cc(-c3csc(N)n3)ccc21 |
| InChI | InChI=1S/C12H12N4S/c1-2-16-7-14-9-5-8(3-4-11(9)16)10-6-17-12(13)15-10/h3-7H,2H2,1H3,(H2,13,15) |
| InChIKey | JGCRILCEYCISOP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |