C9H8N2O2 — CID 115014641
4-(1,2-oxazol-4-yloxy)aniline (PubChem CID 115014641) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 4-(1,2-oxazol-4-yloxy)aniline.
| Compound Name | 4-(1,2-oxazol-4-yloxy)aniline |
|---|---|
| PubChem CID | 115014641 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 4-(1,2-oxazol-4-yloxy)aniline |
| SMILES | Nc1ccc(Oc2cnoc2)cc1 |
| InChI | InChI=1S/C9H8N2O2/c10-7-1-3-8(4-2-7)13-9-5-11-12-6-9/h1-6H,10H2 |
| InChIKey | IGARTLCSJMIPOA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|