C10H9NO3 — CID 117233377
4-(2-methoxyphenoxy)-1,2-oxazole (PubChem CID 117233377) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-(2-methoxyphenoxy)-1,2-oxazole.
| Compound Name | 4-(2-methoxyphenoxy)-1,2-oxazole |
|---|---|
| PubChem CID | 117233377 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 4-(2-methoxyphenoxy)-1,2-oxazole |
| SMILES | COc1ccccc1Oc1cnoc1 |
| InChI | InChI=1S/C10H9NO3/c1-12-9-4-2-3-5-10(9)14-8-6-11-13-7-8/h2-7H,1H3 |
| InChIKey | XABQJPHHHNHVAJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |