C20H35N3O3 — CID 11501484
ethyl 3-[(1S,2S)-1-azido-2-(3-oxononyl)cyclohexyl]propanoate (PubChem CID 11501484) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is ethyl 3-[(1S,2S)-1-azido-2-(3-oxononyl)cyclohexyl]propanoate.
| Compound Name | ethyl 3-[(1S,2S)-1-azido-2-(3-oxononyl)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 11501484 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | ethyl 3-[(1S,2S)-1-azido-2-(3-oxononyl)cyclohexyl]propanoate |
| SMILES | CCCCCCC(=O)CC[C@@H]1CCCC[C@@]1(CCC(=O)OCC)N=[N+]=[N-] |
| InChI | InChI=1S/C20H35N3O3/c1-3-5-6-7-11-18(24)13-12-17-10-8-9-15-20(17,22-23-21)16-14-19(25)26-4-2/h17H,3-16H2,1-2H3/t17-,20-/m0/s1 |
| InChIKey | DQXPLIPQOHBGQG-PXNSSMCTSA-N |
| XLogP | 5.89 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|