C10H12N2O2 — CID 115018979
(5-methoxy-3-methylimidazo[1,2-a]pyridin-2-yl)methanol (PubChem CID 115018979) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (5-methoxy-3-methylimidazo[1,2-a]pyridin-2-yl)methanol.
| Compound Name | (5-methoxy-3-methylimidazo[1,2-a]pyridin-2-yl)methanol |
|---|---|
| PubChem CID | 115018979 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (5-methoxy-3-methylimidazo[1,2-a]pyridin-2-yl)methanol |
| SMILES | COc1cccc2nc(CO)c(C)n12 |
| InChI | InChI=1S/C10H12N2O2/c1-7-8(6-13)11-9-4-3-5-10(14-2)12(7)9/h3-5,13H,6H2,1-2H3 |
| InChIKey | BXXHGFWLYAVXAW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |