C9H9N3O2 — CID 115018402
2-amino-6-methoxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 115018402) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-amino-6-methoxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-amino-6-methoxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115018402 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-amino-6-methoxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | COc1cccc2nc(N)cc(=O)n12 |
| InChI | InChI=1S/C9H9N3O2/c1-14-9-4-2-3-7-11-6(10)5-8(13)12(7)9/h2-5H,10H2,1H3 |
| InChIKey | WNHPBDOENSCQES-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |