C8H7IN2O — CID 125376171
3-iodo-5-methoxyimidazo[1,2-a]pyridine (PubChem CID 125376171) has the molecular formula C8H7IN2O and a molecular weight of 274.06 g/mol. Its IUPAC name is 3-iodo-5-methoxyimidazo[1,2-a]pyridine.
| Compound Name | 3-iodo-5-methoxyimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 125376171 |
| Molecular Formula | C8H7IN2O |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 3-iodo-5-methoxyimidazo[1,2-a]pyridine |
| SMILES | COc1cccc2ncc(I)n12 |
| InChI | InChI=1S/C8H7IN2O/c1-12-8-4-2-3-7-10-5-6(9)11(7)8/h2-5H,1H3 |
| InChIKey | XAKRKXSJURINQU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|