C11H15N3O — CID 115024111
3-(5-methoxyimidazo[1,2-a]pyridin-2-yl)propan-1-amine (PubChem CID 115024111) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(5-methoxyimidazo[1,2-a]pyridin-2-yl)propan-1-amine.
| Compound Name | 3-(5-methoxyimidazo[1,2-a]pyridin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 115024111 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-(5-methoxyimidazo[1,2-a]pyridin-2-yl)propan-1-amine |
| SMILES | COc1cccc2nc(CCCN)cn12 |
| InChI | InChI=1S/C11H15N3O/c1-15-11-6-2-5-10-13-9(4-3-7-12)8-14(10)11/h2,5-6,8H,3-4,7,12H2,1H3 |
| InChIKey | HSOJYBQPUASHND-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |