C11H10N4 — CID 115021388
[1,2,4]triazolo[4,3-a]quinolin-7-ylmethanamine (PubChem CID 115021388) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]quinolin-7-ylmethanamine.
| Compound Name | [1,2,4]triazolo[4,3-a]quinolin-7-ylmethanamine |
|---|---|
| PubChem CID | 115021388 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]quinolin-7-ylmethanamine |
| SMILES | NCc1ccc2c(ccc3nncn32)c1 |
| InChI | InChI=1S/C11H10N4/c12-6-8-1-3-10-9(5-8)2-4-11-14-13-7-15(10)11/h1-5,7H,6,12H2 |
| InChIKey | JZRUHPBZCYAPAU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |