About (2-methylimidazo[1,2-a]quinolin-7-yl)methanol
(2-methylimidazo[1,2-a]quinolin-7-yl)methanol (PubChem CID 115027886) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is (2-methylimidazo[1,2-a]quinolin-7-yl)methanol.
Molecular Properties
| Compound Name | (2-methylimidazo[1,2-a]quinolin-7-yl)methanol |
| PubChem CID | 115027886 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (2-methylimidazo[1,2-a]quinolin-7-yl)methanol |
| SMILES | Cc1cn2c(ccc3cc(CO)ccc32)n1 |
| InChI | InChI=1S/C13H12N2O/c1-9-7-15-12-4-2-10(8-16)6-11(12)3-5-13(15)14-9/h2-7,16H,8H2,1H3 |
| InChIKey | CFHJOGDRNKEVAS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylimidazo[1,2-a]quinolin-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylimidazo[1,2-a]quinolin-7-yl)methanol?
The IUPAC name of (2-methylimidazo[1,2-a]quinolin-7-yl)methanol (CID 115027886) is (2-methylimidazo[1,2-a]quinolin-7-yl)methanol.
What is the SMILES notation for (2-methylimidazo[1,2-a]quinolin-7-yl)methanol?
The canonical SMILES for (2-methylimidazo[1,2-a]quinolin-7-yl)methanol is Cc1cn2c(ccc3cc(CO)ccc32)n1.
What is the InChIKey of (2-methylimidazo[1,2-a]quinolin-7-yl)methanol?
The InChIKey is CFHJOGDRNKEVAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c1-9-7-15-12-4-2-10(8-16)6-11(12)3-5-13(15)14-9/h2-7,16H,8H2,1H3.
What are the key properties of (2-methylimidazo[1,2-a]quinolin-7-yl)methanol?
(2-methylimidazo[1,2-a]quinolin-7-yl)methanol has a molecular weight of 212.25 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylimidazo[1,2-a]quinolin-7-yl)methanol is sourced from PubChem (CID 115027886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).