About naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane
naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane (PubChem CID 18769162) has the molecular formula C17H28O2Si2
and a molecular weight of 320.58 g/mol. Its IUPAC name is naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 18769162 |
| Molecular Formula | C17H28O2Si2 |
| Molecular Weight | 320.58 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H10O.C6H18OSi2/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-8(2,3)7-9(4,5)6/h1-7,12H,8H2;1-6H3 |
| InChIKey | BDKKXQKNDILDGP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane (CID 18769162) is naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane is C[Si](C)(C)O[Si](C)(C)C.OCc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane?
The InChIKey is BDKKXQKNDILDGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.C6H18OSi2/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-8(2,3)7-9(4,5)6/h1-7,12H,8H2;1-6H3.
What are the key properties of naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane?
naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane has a molecular weight of 320.58 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylmethanol;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 18769162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).