C9H13NO4 — CID 115021616
2-(4-tert-butyl-1,3-oxazol-2-yl)-2-hydroxyacetic acid (PubChem CID 115021616) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-oxazol-2-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(4-tert-butyl-1,3-oxazol-2-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 115021616 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(4-tert-butyl-1,3-oxazol-2-yl)-2-hydroxyacetic acid |
| SMILES | CC(C)(C)c1coc(C(O)C(=O)O)n1 |
| InChI | InChI=1S/C9H13NO4/c1-9(2,3)5-4-14-7(10-5)6(11)8(12)13/h4,6,11H,1-3H3,(H,12,13) |
| InChIKey | ALPYVPKLGASFAF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |