C12H13NO2 — CID 115022934
6,7,8,9-tetrahydropyrido[1,2-a]indole-1,9-diol (PubChem CID 115022934) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrido[1,2-a]indole-1,9-diol.
| Compound Name | 6,7,8,9-tetrahydropyrido[1,2-a]indole-1,9-diol |
|---|---|
| PubChem CID | 115022934 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 6,7,8,9-tetrahydropyrido[1,2-a]indole-1,9-diol |
| SMILES | Oc1cccc2c1cc1n2CCCC1O |
| InChI | InChI=1S/C12H13NO2/c14-11-4-1-3-9-8(11)7-10-12(15)5-2-6-13(9)10/h1,3-4,7,12,14-15H,2,5-6H2 |
| InChIKey | IBKUNAJOPBPGSH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |