C12H16N2O — CID 115023573
1-(5-amino-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone (PubChem CID 115023573) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(5-amino-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone.
| Compound Name | 1-(5-amino-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 115023573 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(5-amino-6-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
| SMILES | CC(=O)N1CCc2c(ccc(C)c2N)C1 |
| InChI | InChI=1S/C12H16N2O/c1-8-3-4-10-7-14(9(2)15)6-5-11(10)12(8)13/h3-4H,5-7,13H2,1-2H3 |
| InChIKey | ATNDKDPYTQGBOG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|