C13H27NO — CID 177140878
1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane (PubChem CID 177140878) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane.
| Compound Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane |
|---|---|
| PubChem CID | 177140878 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane |
| SMILES | CC.CC.CC(=O)N1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C9H15NO.2C2H6/c1-7-4-5-10(9(3)11)6-8(7)2;2*1-2/h4-6H2,1-3H3;2*1-2H3 |
| InChIKey | PYZABVZKXGXUEZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|