C10H10ClNO2S — CID 82341872
6-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonyl chloride (PubChem CID 82341872) has the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. Its IUPAC name is 6-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonyl chloride.
| Compound Name | 6-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 82341872 |
| Molecular Formula | C10H10ClNO2S |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 6-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonyl chloride |
| SMILES | CC(=O)N1CCc2c(C(=O)Cl)csc2C1 |
| InChI | InChI=1S/C10H10ClNO2S/c1-6(13)12-3-2-7-8(10(11)14)5-15-9(7)4-12/h5H,2-4H2,1H3 |
| InChIKey | RQMHWDZQUMTTPZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|