C13H18O2 — CID 115024743
3-[(Z)-2-(hydroxymethyl)-3,3-dimethylbut-1-enyl]phenol (PubChem CID 115024743) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-[(Z)-2-(hydroxymethyl)-3,3-dimethylbut-1-enyl]phenol.
| Compound Name | 3-[(Z)-2-(hydroxymethyl)-3,3-dimethylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 115024743 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-[(Z)-2-(hydroxymethyl)-3,3-dimethylbut-1-enyl]phenol |
| SMILES | CC(C)(C)/C(=C/c1cccc(O)c1)CO |
| InChI | InChI=1S/C13H18O2/c1-13(2,3)11(9-14)7-10-5-4-6-12(15)8-10/h4-8,14-15H,9H2,1-3H3/b11-7+ |
| InChIKey | WVYBHWPLZQJYJV-YRNVUSSQSA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |