C9H5FN2O3 — CID 115025652
6-fluoro-4-oxopyrido[1,2-a]pyrimidine-2-carboxylic acid (PubChem CID 115025652) has the molecular formula C9H5FN2O3 and a molecular weight of 208.15 g/mol. Its IUPAC name is 6-fluoro-4-oxopyrido[1,2-a]pyrimidine-2-carboxylic acid.
| Compound Name | 6-fluoro-4-oxopyrido[1,2-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 115025652 |
| Molecular Formula | C9H5FN2O3 |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 6-fluoro-4-oxopyrido[1,2-a]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)n2c(F)cccc2n1 |
| InChI | InChI=1S/C9H5FN2O3/c10-6-2-1-3-7-11-5(9(14)15)4-8(13)12(6)7/h1-4H,(H,14,15) |
| InChIKey | UHFPDZGSLXOJFR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|