C10H15N3O2 — CID 115026341
1-methyl-6-piperidin-2-ylpyrimidine-2,4-dione (PubChem CID 115026341) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-methyl-6-piperidin-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-methyl-6-piperidin-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115026341 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-methyl-6-piperidin-2-ylpyrimidine-2,4-dione |
| SMILES | Cn1c(C2CCCCN2)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O2/c1-13-8(6-9(14)12-10(13)15)7-4-2-3-5-11-7/h6-7,11H,2-5H2,1H3,(H,12,14,15) |
| InChIKey | IJUTUGFHLKUWFQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |