C12H10FN3 — CID 115029021
8-fluoro-9-methylpyrido[3,4-b]indol-3-amine (PubChem CID 115029021) has the molecular formula C12H10FN3 and a molecular weight of 215.23 g/mol. Its IUPAC name is 8-fluoro-9-methylpyrido[3,4-b]indol-3-amine.
| Compound Name | 8-fluoro-9-methylpyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 115029021 |
| Molecular Formula | C12H10FN3 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 8-fluoro-9-methylpyrido[3,4-b]indol-3-amine |
| SMILES | Cn1c2cnc(N)cc2c2cccc(F)c21 |
| InChI | InChI=1S/C12H10FN3/c1-16-10-6-15-11(14)5-8(10)7-3-2-4-9(13)12(7)16/h2-6H,1H3,(H2,14,15) |
| InChIKey | USAMHDHAYJFQSB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |