C26H33NO3Si — CID 11503000
4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 11503000) has the molecular formula C26H33NO3Si and a molecular weight of 435.64 g/mol. Its IUPAC name is 4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | 4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11503000 |
| Molecular Formula | C26H33NO3Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCN1C(=O)OCC1C/C=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H33NO3Si/c1-5-19-27-22(21-29-25(27)28)14-12-13-20-30-31(26(2,3)4,23-15-8-6-9-16-23)24-17-10-7-11-18-24/h5-13,15-18,22H,1,14,19-21H2,2-4H3/b13-12- |
| InChIKey | PIUZLQIRQWKNRL-SEYXRHQNSA-N |
| XLogP | 4.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|