C25H24N6O2 — CID 11503083
N-(5,5-dimethyl-7-oxo-1,4,6,8-tetrahydro-1,8-naphthyridin-4-yl)-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide (PubChem CID 11503083) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is N-(5,5-dimethyl-7-oxo-1,4,6,8-tetrahydro-1,8-naphthyridin-4-yl)-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide.
| Compound Name | N-(5,5-dimethyl-7-oxo-1,4,6,8-tetrahydro-1,8-naphthyridin-4-yl)-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11503083 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-(5,5-dimethyl-7-oxo-1,4,6,8-tetrahydro-1,8-naphthyridin-4-yl)-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide |
| SMILES | CC1(C)CC(=O)NC2=C1C(NC(=O)c1cccnc1Nc1ccc3ccncc3c1)C=CN2 |
| InChI | InChI=1S/C25H24N6O2/c1-25(2)13-20(32)31-23-21(25)19(8-11-28-23)30-24(33)18-4-3-9-27-22(18)29-17-6-5-15-7-10-26-14-16(15)12-17/h3-12,14,19,28H,13H2,1-2H3,(H,27,29)(H,30,33)(H,31,32) |
| InChIKey | NIQVDKVSUNNLBO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |