About N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine
N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine (PubChem CID 115030920) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine.
Molecular Properties
| Compound Name | N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine |
| PubChem CID | 115030920 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine |
| SMILES | c1c(NC2CCCNC2)nnc2c1CCC2 |
| InChI | InChI=1S/C12H18N4/c1-3-9-7-12(16-15-11(9)5-1)14-10-4-2-6-13-8-10/h7,10,13H,1-6,8H2,(H,14,16) |
| InChIKey | SWPDBEVQJDDIMB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine?
The IUPAC name of N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine (CID 115030920) is N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine.
What is the SMILES notation for N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine?
The canonical SMILES for N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine is c1c(NC2CCCNC2)nnc2c1CCC2.
What is the InChIKey of N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine?
The InChIKey is SWPDBEVQJDDIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-3-9-7-12(16-15-11(9)5-1)14-10-4-2-6-13-8-10/h7,10,13H,1-6,8H2,(H,14,16).
What are the key properties of N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine?
N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine has a molecular weight of 218.30 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-3-yl-6,7-dihydro-5H-cyclopenta[c]pyridazin-3-amine is sourced from PubChem (CID 115030920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).