3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid

C11H13N3O2 — CID 115031293

IUPAC3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid
SMILESCN1CCN=C1Nc1cccc(C(=O)O)c1
InChIInChI=1S/C11H13N3O2/c1-14-6-5-12-11(14)13-9-4-2-3-8(7-9)10(15)16/h2-4,7H,5-6H2,1H3,(H,12,13)(H,15,16)
InChIKeyPNRAMHBDQOMNPK-UHFFFAOYSA-N
MW219.24 g/mol
LogP1.10
Rot. Bonds2

About 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid

3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid (PubChem CID 115031293) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid.

Molecular Properties

Compound Name3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid
PubChem CID115031293
Molecular FormulaC11H13N3O2
Molecular Weight219.24 g/mol
Exact Mass219.10
IUPAC Name3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid
SMILESCN1CCN=C1Nc1cccc(C(=O)O)c1
InChIInChI=1S/C11H13N3O2/c1-14-6-5-12-11(14)13-9-4-2-3-8(7-9)10(15)16/h2-4,7H,5-6H2,1H3,(H,12,13)(H,15,16)
InChIKeyPNRAMHBDQOMNPK-UHFFFAOYSA-N
XLogP1.10
TPSA64.93 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 51.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid?
The IUPAC name of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid (CID 115031293) is 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid.
What is the SMILES notation for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid?
The canonical SMILES for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid is CN1CCN=C1Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid?
The InChIKey is PNRAMHBDQOMNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-14-6-5-12-11(14)13-9-4-2-3-8(7-9)10(15)16/h2-4,7H,5-6H2,1H3,(H,12,13)(H,15,16).
What are the key properties of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid?
3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid has a molecular weight of 219.24 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoic acid is sourced from PubChem (CID 115031293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).