C22H17F3N6O2 — CID 11503402
N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide (PubChem CID 11503402) has the molecular formula C22H17F3N6O2 and a molecular weight of 454.41 g/mol. Its IUPAC name is N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide.
| Compound Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 11503402 |
| Molecular Formula | C22H17F3N6O2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nnn(-c3ccnc4c(C(F)(F)F)cccc34)c2C)cc1 |
| InChI | InChI=1S/C22H17F3N6O2/c1-13-19(21(32)29-27-12-14-6-8-15(33-2)9-7-14)28-30-31(13)18-10-11-26-20-16(18)4-3-5-17(20)22(23,24)25/h3-12H,1-2H3,(H,29,32)/b27-12+ |
| InChIKey | AIDPRUKIIGEBHF-KKMKTNMSSA-N |
| XLogP | 3.92 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|